C18H24FN5OS — CID 109422918
N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 109422918) has the molecular formula C18H24FN5OS and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 109422918 |
| Molecular Formula | C18H24FN5OS |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | C/N=C(/NCCNC(=O)Cc1cccc(F)c1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H24FN5OS/c1-13-23-16(12-26-13)11-24(3)18(20-2)22-8-7-21-17(25)10-14-5-4-6-15(19)9-14/h4-6,9,12H,7-8,10-11H2,1-3H3,(H,20,22)(H,21,25) |
| InChIKey | WKYFLVHFHBLLSJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|