C17H22FN5OS — CID 109422706
N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide (PubChem CID 109422706) has the molecular formula C17H22FN5OS and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 109422706 |
| Molecular Formula | C17H22FN5OS |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide |
| SMILES | C/N=C(/NCCNC(=O)c1ccccc1F)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H22FN5OS/c1-12-22-13(11-25-12)10-23(3)17(19-2)21-9-8-20-16(24)14-6-4-5-7-15(14)18/h4-7,11H,8-10H2,1-3H3,(H,19,21)(H,20,24) |
| InChIKey | PFEYFXHNSLTWMP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|