C17H25N5O2S — CID 109420776
N-[3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide (PubChem CID 109420776) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is N-[3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 109420776 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide |
| SMILES | C/N=C(/NCCCNC(=O)c1occc1C)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H25N5O2S/c1-12-6-9-24-15(12)16(23)19-7-5-8-20-17(18-3)22(4)10-14-11-25-13(2)21-14/h6,9,11H,5,7-8,10H2,1-4H3,(H,18,20)(H,19,23) |
| InChIKey | LIRGQGOYZKKJNC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|