C12H23N5O2S2 — CID 109422304
3-[2-(ethylsulfonylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422304) has the molecular formula C12H23N5O2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-[2-(ethylsulfonylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[2-(ethylsulfonylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422304 |
| Molecular Formula | C12H23N5O2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[2-(ethylsulfonylamino)ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C12H23N5O2S2/c1-5-21(18,19)15-7-6-14-12(13-3)17(4)8-11-9-20-10(2)16-11/h9,15H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | NIMDRSGQAVKZGW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|