C14H24N4O2S2 — CID 109424438
1,2-dimethyl-3-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424438) has the molecular formula C14H24N4O2S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424438 |
| Molecular Formula | C14H24N4O2S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1,2-dimethyl-3-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1(CS(C)(=O)=O)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C14H24N4O2S2/c1-11-17-12(8-21-11)7-18(3)13(15-2)16-9-14(5-6-14)10-22(4,19)20/h8H,5-7,9-10H2,1-4H3,(H,15,16) |
| InChIKey | ITHCBAWLXIJEIV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|