C18H23BrN4S — CID 109422738
3-[[1-(2-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109422738) has the molecular formula C18H23BrN4S and a molecular weight of 407.38 g/mol. Its IUPAC name is 3-[[1-(2-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[[1-(2-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109422738 |
| Molecular Formula | C18H23BrN4S |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 3-[[1-(2-bromophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(c2ccccc2Br)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C18H23BrN4S/c1-13-22-14(11-24-13)10-23(3)17(20-2)21-12-18(8-9-18)15-6-4-5-7-16(15)19/h4-7,11H,8-10,12H2,1-3H3,(H,20,21) |
| InChIKey | IFADLJQXPSOGLY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|