C18H24ClIN4S — CID 109422741
3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109422741) has the molecular formula C18H24ClIN4S and a molecular weight of 490.84 g/mol. Its IUPAC name is 3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109422741 |
| Molecular Formula | C18H24ClIN4S |
| Molecular Weight | 490.84 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2cccc(Cl)c2)CC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H23ClN4S.HI/c1-13-22-16(11-24-13)10-23(3)17(20-2)21-12-18(7-8-18)14-5-4-6-15(19)9-14;/h4-6,9,11H,7-8,10,12H2,1-3H3,(H,20,21);1H |
| InChIKey | CPXDKQVKHUMYLJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.84 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|