C17H23ClN4S2 — CID 109421486
3-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109421486) has the molecular formula C17H23ClN4S2 and a molecular weight of 382.99 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109421486 |
| Molecular Formula | C17H23ClN4S2 |
| Molecular Weight | 382.99 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC(SC)c1cccc(Cl)c1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H23ClN4S2/c1-12-21-15(11-24-12)10-22(3)17(19-2)20-9-16(23-4)13-6-5-7-14(18)8-13/h5-8,11,16H,9-10H2,1-4H3,(H,19,20) |
| InChIKey | RXRCTIOEVFOJSH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.99 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|