C16H21ClN4S2 — CID 109424540
3-[2-(4-chlorophenyl)sulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424540) has the molecular formula C16H21ClN4S2 and a molecular weight of 368.96 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[2-(4-chlorophenyl)sulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424540 |
| Molecular Formula | C16H21ClN4S2 |
| Molecular Weight | 368.96 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfanylethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C16H21ClN4S2/c1-12-20-14(11-23-12)10-21(3)16(18-2)19-8-9-22-15-6-4-13(17)5-7-15/h4-7,11H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | VKPAHSOBYDKVNG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|