C16H22N4S — CID 109424994
1,2-dimethyl-3-[(3-methylphenyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424994) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(3-methylphenyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(3-methylphenyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424994 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1,2-dimethyl-3-[(3-methylphenyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(C)c1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C16H22N4S/c1-12-6-5-7-14(8-12)9-18-16(17-3)20(4)10-15-11-21-13(2)19-15/h5-8,11H,9-10H2,1-4H3,(H,17,18) |
| InChIKey | MVRPIVSJAHLTMZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|