C15H20BrIN4S — CID 109420849
3-[(3-bromophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109420849) has the molecular formula C15H20BrIN4S and a molecular weight of 495.23 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[(3-bromophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420849 |
| Molecular Formula | C15H20BrIN4S |
| Molecular Weight | 495.23 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(Br)c1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C15H19BrN4S.HI/c1-11-19-14(10-21-11)9-20(3)15(17-2)18-8-12-5-4-6-13(16)7-12;/h4-7,10H,8-9H2,1-3H3,(H,17,18);1H |
| InChIKey | NNHQIXDGLWNJDD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|