C17H24FN5S — CID 109421678
3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109421678) has the molecular formula C17H24FN5S and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109421678 |
| Molecular Formula | C17H24FN5S |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N(C)C)c(F)c1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H24FN5S/c1-12-21-14(11-24-12)10-23(5)17(19-2)20-9-13-6-7-16(22(3)4)15(18)8-13/h6-8,11H,9-10H2,1-5H3,(H,19,20) |
| InChIKey | FKWVGDRHRRVWGL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|