C17H23FN4OS — CID 109423880
3-[(4-ethoxy-3-fluorophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423880) has the molecular formula C17H23FN4OS and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-[(4-ethoxy-3-fluorophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[(4-ethoxy-3-fluorophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423880 |
| Molecular Formula | C17H23FN4OS |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[(4-ethoxy-3-fluorophenyl)methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCOc1ccc(CN/C(=N/C)N(C)Cc2csc(C)n2)cc1F |
| InChI | InChI=1S/C17H23FN4OS/c1-5-23-16-7-6-13(8-15(16)18)9-20-17(19-3)22(4)10-14-11-24-12(2)21-14/h6-8,11H,5,9-10H2,1-4H3,(H,19,20) |
| InChIKey | OQKCKSZFZDWPOA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|