C18H28IN5OS — CID 109420991
3-[[4-(2-methoxyethylamino)phenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109420991) has the molecular formula C18H28IN5OS and a molecular weight of 489.43 g/mol. Its IUPAC name is 3-[[4-(2-methoxyethylamino)phenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[[4-(2-methoxyethylamino)phenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420991 |
| Molecular Formula | C18H28IN5OS |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 3-[[4-(2-methoxyethylamino)phenyl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NCCOC)cc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H27N5OS.HI/c1-14-22-17(13-25-14)12-23(3)18(19-2)21-11-15-5-7-16(8-6-15)20-9-10-24-4;/h5-8,13,20H,9-12H2,1-4H3,(H,19,21);1H |
| InChIKey | NYUHIDOJNAPWHI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|