C20H29N5OS — CID 109421658
N-butan-2-yl-4-[[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 109421658) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-4-[[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109421658 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-butan-2-yl-4-[[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(CN/C(=N/C)N(C)Cc2csc(C)n2)cc1 |
| InChI | InChI=1S/C20H29N5OS/c1-6-14(2)23-19(26)17-9-7-16(8-10-17)11-22-20(21-4)25(5)12-18-13-27-15(3)24-18/h7-10,13-14H,6,11-12H2,1-5H3,(H,21,22)(H,23,26) |
| InChIKey | OLTONSCPCXLFPY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|