C23H36IN5O2S — CID 109456839
N-butan-2-yl-4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 109456839) has the molecular formula C23H36IN5O2S and a molecular weight of 573.55 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109456839 |
| Molecular Formula | C23H36IN5O2S |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | N-butan-2-yl-4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC(C)CC)cc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C23H35N5O2S.HI/c1-7-16(3)26-21(29)19-11-9-18(10-12-19)13-25-23(24-8-2)28(5)14-20-15-31-22(27-20)17(4)30-6;/h9-12,15-17H,7-8,13-14H2,1-6H3,(H,24,25)(H,26,29);1H |
| InChIKey | QPCDNVQTFJVJOG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|