C19H27FN4OS — CID 109456844
3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine (PubChem CID 109456844) has the molecular formula C19H27FN4OS and a molecular weight of 378.52 g/mol. Its IUPAC name is 3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine.
| Compound Name | 3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 109456844 |
| Molecular Formula | C19H27FN4OS |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C19H27FN4OS/c1-6-21-19(22-10-15-7-8-17(20)13(2)9-15)24(4)11-16-12-26-18(23-16)14(3)25-5/h7-9,12,14H,6,10-11H2,1-5H3,(H,21,22) |
| InChIKey | HHQWIYTWLWBGIP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|