C22H35IN6O2S — CID 109456575
1-[4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 109456575) has the molecular formula C22H35IN6O2S and a molecular weight of 574.53 g/mol. Its IUPAC name is 1-[4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 109456575 |
| Molecular Formula | C22H35IN6O2S |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-[4-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C22H34N6O2S.HI/c1-7-23-21(28(5)13-19-14-31-20(26-19)16(4)30-6)24-12-17-8-10-18(11-9-17)27-22(29)25-15(2)3;/h8-11,14-16H,7,12-13H2,1-6H3,(H,23,24)(H2,25,27,29);1H |
| InChIKey | YQGLKOHYKGIENH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|