C23H35N5O2S — CID 109456830
N-[3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-methylbutanamide (PubChem CID 109456830) has the molecular formula C23H35N5O2S and a molecular weight of 445.63 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 109456830 |
| Molecular Formula | C23H35N5O2S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]phenyl]-3-methylbutanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CC(C)C)c1)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C23H35N5O2S/c1-7-24-23(28(5)14-20-15-31-22(27-20)17(4)30-6)25-13-18-9-8-10-19(12-18)26-21(29)11-16(2)3/h8-10,12,15-17H,7,11,13-14H2,1-6H3,(H,24,25)(H,26,29) |
| InChIKey | SQXYVVNSFXBJGY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|