C19H28IN5O2S — CID 109456627
3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 109456627) has the molecular formula C19H28IN5O2S and a molecular weight of 517.44 g/mol. Its IUPAC name is 3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109456627 |
| Molecular Formula | C19H28IN5O2S |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 3-[[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C19H27N5O2S.HI/c1-5-21-19(22-10-14-7-6-8-15(9-14)17(20)25)24(3)11-16-12-27-18(23-16)13(2)26-4;/h6-9,12-13H,5,10-11H2,1-4H3,(H2,20,25)(H,21,22);1H |
| InChIKey | DUJCRSUQHPQUIO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|