C16H30IN5O2S — CID 109455547
3-[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 109455547) has the molecular formula C16H30IN5O2S and a molecular weight of 483.42 g/mol. Its IUPAC name is 3-[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109455547 |
| Molecular Formula | C16H30IN5O2S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 3-[[ethylamino-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C16H29N5O2S.HI/c1-7-18-15(19-10-16(3,4)14(17)22)21(5)8-12-9-24-13(20-12)11(2)23-6;/h9,11H,7-8,10H2,1-6H3,(H2,17,22)(H,18,19);1H |
| InChIKey | DTFPEHAXVULSEN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|