C16H24BrIN4OS2 — CID 109456855
2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide (PubChem CID 109456855) has the molecular formula C16H24BrIN4OS2 and a molecular weight of 559.34 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109456855 |
| Molecular Formula | C16H24BrIN4OS2 |
| Molecular Weight | 559.34 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C16H23BrN4OS2.HI/c1-5-18-16(19-7-14-6-12(17)9-23-14)21(3)8-13-10-24-15(20-13)11(2)22-4;/h6,9-11H,5,7-8H2,1-4H3,(H,18,19);1H |
| InChIKey | ZJIQNWKXTGCPDJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|