C14H19BrN4S2 — CID 109424794
2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424794) has the molecular formula C14H19BrN4S2 and a molecular weight of 387.37 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424794 |
| Molecular Formula | C14H19BrN4S2 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C14H19BrN4S2/c1-4-16-14(17-6-13-5-11(15)8-21-13)19(3)7-12-9-20-10(2)18-12/h5,8-9H,4,6-7H2,1-3H3,(H,16,17) |
| InChIKey | DOZDAXPIKKBOAV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|