C15H24IN5S2 — CID 109423121
3-ethyl-1-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423121) has the molecular formula C15H24IN5S2 and a molecular weight of 465.43 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423121 |
| Molecular Formula | C15H24IN5S2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(C)n1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C15H23N5S2.HI/c1-5-16-15(17-7-6-13-9-21-11(2)18-13)20(4)8-14-10-22-12(3)19-14;/h9-10H,5-8H2,1-4H3,(H,16,17);1H |
| InChIKey | GUYUCEYNZZZMJA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|