C14H25IN4S — CID 109423057
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(E)-pent-3-enyl]guanidine;hydroiodide (PubChem CID 109423057) has the molecular formula C14H25IN4S and a molecular weight of 408.35 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(E)-pent-3-enyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(E)-pent-3-enyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423057 |
| Molecular Formula | C14H25IN4S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[(E)-pent-3-enyl]guanidine;hydroiodide |
| SMILES | C/C=C/CC/N=C(\NCC)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C14H24N4S.HI/c1-5-7-8-9-16-14(15-6-2)18(4)10-13-11-19-12(3)17-13;/h5,7,11H,6,8-10H2,1-4H3,(H,15,16);1H/b7-5+; |
| InChIKey | HQHZDAZVAUHUHV-GZOLSCHFSA-N |
| XLogP | 3.43 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|