C14H27IN4O3S2 — CID 109421849
3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109421849) has the molecular formula C14H27IN4O3S2 and a molecular weight of 490.43 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421849 |
| Molecular Formula | C14H27IN4O3S2 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C14H26N4O3S2.HI/c1-5-15-14(16-6-7-21-8-9-23(4,19)20)18(3)10-13-11-22-12(2)17-13;/h11H,5-10H2,1-4H3,(H,15,16);1H |
| InChIKey | RULCXNFYSJFJGQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|