C16H29IN4O3S2 — CID 109425211
3-ethyl-1-methyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109425211) has the molecular formula C16H29IN4O3S2 and a molecular weight of 516.47 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109425211 |
| Molecular Formula | C16H29IN4O3S2 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 3-ethyl-1-methyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(S(C)(=O)=O)CCOCC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C16H28N4O3S2.HI/c1-5-17-15(20(3)10-14-11-24-13(2)19-14)18-12-16(25(4,21)22)6-8-23-9-7-16;/h11H,5-10,12H2,1-4H3,(H,17,18);1H |
| InChIKey | OIAJKOWQRSSGJB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|