C21H37N5OS — CID 109425178
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]guanidine (PubChem CID 109425178) has the molecular formula C21H37N5OS and a molecular weight of 407.63 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109425178 |
| Molecular Formula | C21H37N5OS |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CN2CCOCC2)CCCCC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H37N5OS/c1-4-22-20(25(3)14-19-15-28-18(2)24-19)23-16-21(8-6-5-7-9-21)17-26-10-12-27-13-11-26/h15H,4-14,16-17H2,1-3H3,(H,22,23) |
| InChIKey | ZJKSNPFCNSUXSC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|