C19H26FIN4S — CID 109424795
3-ethyl-2-[[1-(4-fluorophenyl)cyclopropyl]methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109424795) has the molecular formula C19H26FIN4S and a molecular weight of 488.41 g/mol. Its IUPAC name is 3-ethyl-2-[[1-(4-fluorophenyl)cyclopropyl]methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[[1-(4-fluorophenyl)cyclopropyl]methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109424795 |
| Molecular Formula | C19H26FIN4S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 3-ethyl-2-[[1-(4-fluorophenyl)cyclopropyl]methyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(F)cc2)CC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C19H25FN4S.HI/c1-4-21-18(24(3)11-17-12-25-14(2)23-17)22-13-19(9-10-19)15-5-7-16(20)8-6-15;/h5-8,12H,4,9-11,13H2,1-3H3,(H,21,22);1H |
| InChIKey | LFHNBKBTBYCCEN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|