C14H25BrIN3O3S2 — CID 111517245
1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111517245) has the molecular formula C14H25BrIN3O3S2 and a molecular weight of 554.31 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111517245 |
| Molecular Formula | C14H25BrIN3O3S2 |
| Molecular Weight | 554.31 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)N(C)Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C14H24BrN3O3S2.HI/c1-4-16-14(17-7-8-21-9-10-23(3,19)20)18(2)11-12-5-6-13(15)22-12;/h5-6H,4,7-11H2,1-3H3,(H,16,17);1H |
| InChIKey | LOADSMDWMWWTJB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|