C17H29FIN3O4S — CID 111517613
3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111517613) has the molecular formula C17H29FIN3O4S and a molecular weight of 517.41 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111517613 |
| Molecular Formula | C17H29FIN3O4S |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)N(C)Cc1ccc(OC)c(F)c1.I |
| InChI | InChI=1S/C17H28FN3O4S.HI/c1-5-19-17(20-8-9-25-10-11-26(4,22)23)21(2)13-14-6-7-16(24-3)15(18)12-14;/h6-7,12H,5,8-11,13H2,1-4H3,(H,19,20);1H |
| InChIKey | RDVVGUCEBHTXNZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|