C16H26FN3O4S — CID 111517606
1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine (PubChem CID 111517606) has the molecular formula C16H26FN3O4S and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111517606 |
| Molecular Formula | C16H26FN3O4S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)N(C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C16H26FN3O4S/c1-18-16(19-7-8-24-9-10-25(4,21)22)20(2)12-13-5-6-15(23-3)14(17)11-13/h5-6,11H,7-10,12H2,1-4H3,(H,18,19) |
| InChIKey | ZMMNQISLHKQXHP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|