C15H24BrN3O3S — CID 111514566
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine (PubChem CID 111514566) has the molecular formula C15H24BrN3O3S and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111514566 |
| Molecular Formula | C15H24BrN3O3S |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H24BrN3O3S/c1-17-15(18-8-9-22-10-11-23(3,20)21)19(2)12-13-4-6-14(16)7-5-13/h4-7H,8-12H2,1-3H3,(H,17,18) |
| InChIKey | ZKQLZIDJRUDHDP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|