C13H22IN3O2S — CID 110950925
1-benzyl-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 110950925) has the molecular formula C13H22IN3O2S and a molecular weight of 411.31 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-benzyl-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110950925 |
| Molecular Formula | C13H22IN3O2S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C13H21N3O2S.HI/c1-14-13(15-9-10-19(3,17)18)16(2)11-12-7-5-4-6-8-12;/h4-8H,9-11H2,1-3H3,(H,14,15);1H |
| InChIKey | YIZZHPAJGZOCJT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|