C19H23F3IN3O2S — CID 111299600
3-[2-(benzenesulfonyl)ethyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111299600) has the molecular formula C19H23F3IN3O2S and a molecular weight of 541.38 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)ethyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(benzenesulfonyl)ethyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299600 |
| Molecular Formula | C19H23F3IN3O2S |
| Molecular Weight | 541.38 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 3-[2-(benzenesulfonyl)ethyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C19H22F3N3O2S.HI/c1-23-18(24-12-13-28(26,27)17-6-4-3-5-7-17)25(2)14-15-8-10-16(11-9-15)19(20,21)22;/h3-11H,12-14H2,1-2H3,(H,23,24);1H |
| InChIKey | URYHSVOTTHJAOB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|