C21H27F3IN3O2S — CID 111300066
3-(3-benzylsulfonylpropyl)-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111300066) has the molecular formula C21H27F3IN3O2S and a molecular weight of 569.43 g/mol. Its IUPAC name is 3-(3-benzylsulfonylpropyl)-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-(3-benzylsulfonylpropyl)-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111300066 |
| Molecular Formula | C21H27F3IN3O2S |
| Molecular Weight | 569.43 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | 3-(3-benzylsulfonylpropyl)-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(=O)(=O)Cc1ccccc1)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C21H26F3N3O2S.HI/c1-25-20(27(2)15-17-9-11-19(12-10-17)21(22,23)24)26-13-6-14-30(28,29)16-18-7-4-3-5-8-18;/h3-5,7-12H,6,13-16H2,1-2H3,(H,25,26);1H |
| InChIKey | PBFFCEZUJWWRCZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|