C22H31N3O2S — CID 111283291
3-(3-benzylsulfonylpropyl)-1-[(4-ethylphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111283291) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 3-(3-benzylsulfonylpropyl)-1-[(4-ethylphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-(3-benzylsulfonylpropyl)-1-[(4-ethylphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111283291 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-(3-benzylsulfonylpropyl)-1-[(4-ethylphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | CCc1ccc(CN(C)/C(=N/C)NCCCS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H31N3O2S/c1-4-19-11-13-20(14-12-19)17-25(3)22(23-2)24-15-8-16-28(26,27)18-21-9-6-5-7-10-21/h5-7,9-14H,4,8,15-18H2,1-3H3,(H,23,24) |
| InChIKey | IQDQBVAMOQYYPB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|