C15H25N3 — CID 110951158
1-benzyl-1,2-dimethyl-3-pentylguanidine (PubChem CID 110951158) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-pentylguanidine.
| Compound Name | 1-benzyl-1,2-dimethyl-3-pentylguanidine |
|---|---|
| PubChem CID | 110951158 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-pentylguanidine |
| SMILES | CCCCCN/C(=N\C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H25N3/c1-4-5-9-12-17-15(16-2)18(3)13-14-10-7-6-8-11-14/h6-8,10-11H,4-5,9,12-13H2,1-3H3,(H,16,17) |
| InChIKey | BBMQIPKRMSNMCT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|