C19H26N4 — CID 110950812
3-(3-anilinopropyl)-1-benzyl-1,2-dimethylguanidine (PubChem CID 110950812) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is 3-(3-anilinopropyl)-1-benzyl-1,2-dimethylguanidine.
| Compound Name | 3-(3-anilinopropyl)-1-benzyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 110950812 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 3-(3-anilinopropyl)-1-benzyl-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCCCNc1ccccc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H26N4/c1-20-19(23(2)16-17-10-5-3-6-11-17)22-15-9-14-21-18-12-7-4-8-13-18/h3-8,10-13,21H,9,14-16H2,1-2H3,(H,20,22) |
| InChIKey | XMQFLWBVWDHJBU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|