C16H25F3N4 — CID 110951450
1-benzyl-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 110951450) has the molecular formula C16H25F3N4 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-benzyl-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 110951450 |
| Molecular Formula | C16H25F3N4 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H25F3N4/c1-20-15(23(3)12-14-8-5-4-6-9-14)21-10-7-11-22(2)13-16(17,18)19/h4-6,8-9H,7,10-13H2,1-3H3,(H,20,21) |
| InChIKey | UQIBUPDWJQWIFX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|