C14H24IN3O2S — CID 110951477
1-benzyl-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 110951477) has the molecular formula C14H24IN3O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-benzyl-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110951477 |
| Molecular Formula | C14H24IN3O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C14H23N3O2S.HI/c1-15-14(16-10-7-11-20(3,18)19)17(2)12-13-8-5-4-6-9-13;/h4-6,8-9H,7,10-12H2,1-3H3,(H,15,16);1H |
| InChIKey | QLXQYSURKIEOSF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|