C14H22BrN3O2S — CID 111293139
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine (PubChem CID 111293139) has the molecular formula C14H22BrN3O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111293139 |
| Molecular Formula | C14H22BrN3O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-(3-methylsulfonylpropyl)guanidine |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrN3O2S/c1-16-14(17-9-4-10-21(3,19)20)18(2)11-12-5-7-13(15)8-6-12/h5-8H,4,9-11H2,1-3H3,(H,16,17) |
| InChIKey | VWIIMERTHROKQV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|