C21H29N3O3S — CID 111275473
3-[3-(benzenesulfonyl)propyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111275473) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 3-[3-(benzenesulfonyl)propyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[3-(benzenesulfonyl)propyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111275473 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[3-(benzenesulfonyl)propyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | CCOc1ccc(CN(C)/C(=N/C)NCCCS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-4-27-19-13-11-18(12-14-19)17-24(3)21(22-2)23-15-8-16-28(25,26)20-9-6-5-7-10-20/h5-7,9-14H,4,8,15-17H2,1-3H3,(H,22,23) |
| InChIKey | FNNYTUIWXMBCAH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|