C19H25BrIN3O2S — CID 111276242
3-[3-(benzenesulfonyl)propyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111276242) has the molecular formula C19H25BrIN3O2S and a molecular weight of 566.30 g/mol. Its IUPAC name is 3-[3-(benzenesulfonyl)propyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[3-(benzenesulfonyl)propyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111276242 |
| Molecular Formula | C19H25BrIN3O2S |
| Molecular Weight | 566.30 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | 3-[3-(benzenesulfonyl)propyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C19H24BrN3O2S.HI/c1-21-19(23(2)15-16-9-6-7-12-18(16)20)22-13-8-14-26(24,25)17-10-4-3-5-11-17;/h3-7,9-12H,8,13-15H2,1-2H3,(H,21,22);1H |
| InChIKey | XBUZQERBESSOTH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|