C14H24BrIN4O2S — CID 111276322
1-[(2-bromophenyl)methyl]-3-[3-(methanesulfonamido)propyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111276322) has the molecular formula C14H24BrIN4O2S and a molecular weight of 519.25 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[3-(methanesulfonamido)propyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[3-(methanesulfonamido)propyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111276322 |
| Molecular Formula | C14H24BrIN4O2S |
| Molecular Weight | 519.25 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[3-(methanesulfonamido)propyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C14H23BrN4O2S.HI/c1-16-14(17-9-6-10-18-22(3,20)21)19(2)11-12-7-4-5-8-13(12)15;/h4-5,7-8,18H,6,9-11H2,1-3H3,(H,16,17);1H |
| InChIKey | KIGXMLDBUFWQBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|