C14H20BrN3O2 — CID 111275951
methyl 3-[[N-[(2-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate (PubChem CID 111275951) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is methyl 3-[[N-[(2-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate.
| Compound Name | methyl 3-[[N-[(2-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111275951 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | methyl 3-[[N-[(2-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C14H20BrN3O2/c1-16-14(17-9-8-13(19)20-3)18(2)10-11-6-4-5-7-12(11)15/h4-7H,8-10H2,1-3H3,(H,16,17) |
| InChIKey | JLLVUMYEYIURFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|