C15H24IN3O3 — CID 111281650
methyl 3-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111281650) has the molecular formula C15H24IN3O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is methyl 3-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111281650 |
| Molecular Formula | C15H24IN3O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl 3-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C15H23N3O3.HI/c1-16-15(17-10-9-14(19)21-4)18(2)11-12-7-5-6-8-13(12)20-3;/h5-8H,9-11H2,1-4H3,(H,16,17);1H |
| InChIKey | JMAWYHRGSVKVQU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|