C17H28BrN3O2 — CID 111275855
1-[(2-bromophenyl)methyl]-3-[4-(2-methoxyethoxy)butyl]-1,2-dimethylguanidine (PubChem CID 111275855) has the molecular formula C17H28BrN3O2 and a molecular weight of 386.33 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[4-(2-methoxyethoxy)butyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[4-(2-methoxyethoxy)butyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111275855 |
| Molecular Formula | C17H28BrN3O2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[4-(2-methoxyethoxy)butyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCCCOCCOC)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C17H28BrN3O2/c1-19-17(20-10-6-7-11-23-13-12-22-3)21(2)14-15-8-4-5-9-16(15)18/h4-5,8-9H,6-7,10-14H2,1-3H3,(H,19,20) |
| InChIKey | JJOYKFRVVKRFIJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|