C18H29BrN4O — CID 111276077
1-[(2-bromophenyl)methyl]-3-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-1,2-dimethylguanidine (PubChem CID 111276077) has the molecular formula C18H29BrN4O and a molecular weight of 397.36 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111276077 |
| Molecular Formula | C18H29BrN4O |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCN(CCOC)C1CC1)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C18H29BrN4O/c1-20-18(22(2)14-15-6-4-5-7-17(15)19)21-10-11-23(12-13-24-3)16-8-9-16/h4-7,16H,8-14H2,1-3H3,(H,20,21) |
| InChIKey | CUOKRUIBPADZQQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|