C18H29BrIN5O — CID 111276108
3-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111276108) has the molecular formula C18H29BrIN5O and a molecular weight of 538.27 g/mol. Its IUPAC name is 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111276108 |
| Molecular Formula | C18H29BrIN5O |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 3-[2-(4-acetylpiperazin-1-yl)ethyl]-1-[(2-bromophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCN(C(C)=O)CC1)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C18H28BrN5O.HI/c1-15(25)24-12-10-23(11-13-24)9-8-21-18(20-2)22(3)14-16-6-4-5-7-17(16)19;/h4-7H,8-14H2,1-3H3,(H,20,21);1H |
| InChIKey | UWGLCGKGMDQPAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|